![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Balkan Bollywood ..> | 2023-12-04 02:01 | 15M | |
| 02 Atashgah (feat. G..> | 2023-12-04 02:01 | 35M | |
| 03 Aaj Ki Raat (feat..> | 2023-12-04 02:01 | 12M | |
| 04 Blue as the Turqu..> | 2023-12-04 02:01 | 13M | |
| 05 Blue as the Turqu..> | 2023-12-04 02:01 | 14M | |
| 06 Blue as the Turqu..> | 2023-12-04 02:01 | 9.3M | |
| 07 Blue as the Turqu..> | 2023-12-04 02:01 | 13M | |
| 08 Butcher's Air (fe..> | 2023-12-04 02:01 | 15M | |